C16H36N5O+ — CID 58264359
[[6-amino-2-(1-aminoethylideneamino)-2-methylhexanoyl]amino]methyl-(3-methylpentan-3-yl)azanium (PubChem CID 58264359) has the molecular formula C16H36N5O+ and a molecular weight of 314.50 g/mol. Its IUPAC name is [[6-amino-2-(1-aminoethylideneamino)-2-methylhexanoyl]amino]methyl-(3-methylpentan-3-yl)azanium.
| Compound Name | [[6-amino-2-(1-aminoethylideneamino)-2-methylhexanoyl]amino]methyl-(3-methylpentan-3-yl)azanium |
|---|---|
| PubChem CID | 58264359 |
| Molecular Formula | C16H36N5O+ |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.29 |
| IUPAC Name | [[6-amino-2-(1-aminoethylideneamino)-2-methylhexanoyl]amino]methyl-(3-methylpentan-3-yl)azanium |
| SMILES | CCC(C)(CC)[NH2+]CNC(=O)C(C)(CCCCN)/N=C(\C)N |
| InChI | InChI=1S/C16H35N5O/c1-6-15(4,7-2)20-12-19-14(22)16(5,21-13(3)18)10-8-9-11-17/h20H,6-12,17H2,1-5H3,(H2,18,21)(H,19,22)/p+1 |
| InChIKey | GTKNAMANKUJDOR-UHFFFAOYSA-O |
| XLogP | 0.47 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|