C18H38N6O — CID 58264356
2-(diaminomethylideneamino)-8-imino-2-methyl-N-[(3-methylpentan-3-ylamino)methyl]nonanamide (PubChem CID 58264356) has the molecular formula C18H38N6O and a molecular weight of 354.54 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-8-imino-2-methyl-N-[(3-methylpentan-3-ylamino)methyl]nonanamide.
| Compound Name | 2-(diaminomethylideneamino)-8-imino-2-methyl-N-[(3-methylpentan-3-ylamino)methyl]nonanamide |
|---|---|
| PubChem CID | 58264356 |
| Molecular Formula | C18H38N6O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | 2-(diaminomethylideneamino)-8-imino-2-methyl-N-[(3-methylpentan-3-ylamino)methyl]nonanamide |
| SMILES | [H]/N=C(\C)CCCCCC(C)(N=C(N)N)C(=O)NCNC(C)(CC)CC |
| InChI | InChI=1S/C18H38N6O/c1-6-17(4,7-2)23-13-22-15(25)18(5,24-16(20)21)12-10-8-9-11-14(3)19/h19,23H,6-13H2,1-5H3,(H,22,25)(H4,20,21,24)/b19-14+ |
| InChIKey | HYNMFFXCJVTZAT-XMHGGMMESA-N |
| XLogP | 2.25 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|