C20H36N2O5 — CID 123884198
2-[2-[4-(3-methylpentan-3-ylimino)pentanoyloxy]ethoxy]ethyl 4-iminopentanoate (PubChem CID 123884198) has the molecular formula C20H36N2O5 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-[2-[4-(3-methylpentan-3-ylimino)pentanoyloxy]ethoxy]ethyl 4-iminopentanoate.
| Compound Name | 2-[2-[4-(3-methylpentan-3-ylimino)pentanoyloxy]ethoxy]ethyl 4-iminopentanoate |
|---|---|
| PubChem CID | 123884198 |
| Molecular Formula | C20H36N2O5 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 2-[2-[4-(3-methylpentan-3-ylimino)pentanoyloxy]ethoxy]ethyl 4-iminopentanoate |
| SMILES | [H]/N=C(\C)CCC(=O)OCCOCCOC(=O)CC/C(C)=N/C(C)(CC)CC |
| InChI | InChI=1S/C20H36N2O5/c1-6-20(5,7-2)22-17(4)9-11-19(24)27-15-13-25-12-14-26-18(23)10-8-16(3)21/h21H,6-15H2,1-5H3/b21-16+,22-17+ |
| InChIKey | HMRFEHKUCCDOKI-LPFJTETCSA-N |
| XLogP | 3.73 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|