C20H40N2O6 — CID 144806601
2-[3-[2-(3-iminobutylperoxy)ethoxy]propoxy]ethyl 5-amino-4,4,5-trimethylhexanoate (PubChem CID 144806601) has the molecular formula C20H40N2O6 and a molecular weight of 404.55 g/mol. Its IUPAC name is 2-[3-[2-(3-iminobutylperoxy)ethoxy]propoxy]ethyl 5-amino-4,4,5-trimethylhexanoate.
| Compound Name | 2-[3-[2-(3-iminobutylperoxy)ethoxy]propoxy]ethyl 5-amino-4,4,5-trimethylhexanoate |
|---|---|
| PubChem CID | 144806601 |
| Molecular Formula | C20H40N2O6 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 2-[3-[2-(3-iminobutylperoxy)ethoxy]propoxy]ethyl 5-amino-4,4,5-trimethylhexanoate |
| SMILES | [H]/N=C(\C)CCOOCCOCCCOCCOC(=O)CCC(C)(C)C(C)(C)N |
| InChI | InChI=1S/C20H40N2O6/c1-17(21)8-12-27-28-16-14-25-11-6-10-24-13-15-26-18(23)7-9-19(2,3)20(4,5)22/h21H,6-16,22H2,1-5H3/b21-17+ |
| InChIKey | ZAEBDUMVRQAXLW-HEHNFIMWSA-N |
| XLogP | 2.87 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|