C13H24O10P- — CID 58264451
[(2R)-2-butanoyloxy-3-propanoyloxypropyl] 2,3-dihydroxypropyl phosphate (PubChem CID 58264451) has the molecular formula C13H24O10P- and a molecular weight of 371.30 g/mol. Its IUPAC name is [(2R)-2-butanoyloxy-3-propanoyloxypropyl] 2,3-dihydroxypropyl phosphate.
| Compound Name | [(2R)-2-butanoyloxy-3-propanoyloxypropyl] 2,3-dihydroxypropyl phosphate |
|---|---|
| PubChem CID | 58264451 |
| Molecular Formula | C13H24O10P- |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | [(2R)-2-butanoyloxy-3-propanoyloxypropyl] 2,3-dihydroxypropyl phosphate |
| SMILES | CCCC(=O)O[C@H](COC(=O)CC)COP(=O)([O-])OCC(O)CO |
| InChI | InChI=1S/C13H25O10P/c1-3-5-13(17)23-11(8-20-12(16)4-2)9-22-24(18,19)21-7-10(15)6-14/h10-11,14-15H,3-9H2,1-2H3,(H,18,19)/p-1/t10?,11-/m1/s1 |
| InChIKey | ARRIVVHIBIOCFF-RRKGBCIJSA-M |
| XLogP | -0.49 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|