C12H22NaO10P — CID 158820937
sodium [(2R)-2-butanoyloxy-3-propanoyloxypropyl] 1,2-dihydroxyethyl phosphate (PubChem CID 158820937) has the molecular formula C12H22NaO10P and a molecular weight of 380.26 g/mol. Its IUPAC name is sodium [(2R)-2-butanoyloxy-3-propanoyloxypropyl] 1,2-dihydroxyethyl phosphate.
| Compound Name | sodium [(2R)-2-butanoyloxy-3-propanoyloxypropyl] 1,2-dihydroxyethyl phosphate |
|---|---|
| PubChem CID | 158820937 |
| Molecular Formula | C12H22NaO10P |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | sodium [(2R)-2-butanoyloxy-3-propanoyloxypropyl] 1,2-dihydroxyethyl phosphate |
| SMILES | CCCC(=O)O[C@H](COC(=O)CC)COP(=O)([O-])OC(O)CO.[Na+] |
| InChI | InChI=1S/C12H23O10P.Na/c1-3-5-11(15)21-9(7-19-10(14)4-2)8-20-23(17,18)22-12(16)6-13;/h9,12-13,16H,3-8H2,1-2H3,(H,17,18);/q;+1/p-1/t9-,12?;/m1./s1 |
| InChIKey | ZGDTYHWJCOCLFO-SWHRJYHISA-M |
| XLogP | -3.53 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|