C25H23N5O2S — CID 58265777
1-[1-[4-[(E)-methoxyiminomethyl]phenyl]-3-(6-methyl-3-pyridinyl)-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-7-yl]propan-2-one (PubChem CID 58265777) has the molecular formula C25H23N5O2S and a molecular weight of 457.56 g/mol. Its IUPAC name is 1-[1-[4-[(E)-methoxyiminomethyl]phenyl]-3-(6-methyl-3-pyridinyl)-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-7-yl]propan-2-one.
| Compound Name | 1-[1-[4-[(E)-methoxyiminomethyl]phenyl]-3-(6-methyl-3-pyridinyl)-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-7-yl]propan-2-one |
|---|---|
| PubChem CID | 58265777 |
| Molecular Formula | C25H23N5O2S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 1-[1-[4-[(E)-methoxyiminomethyl]phenyl]-3-(6-methyl-3-pyridinyl)-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-7-yl]propan-2-one |
| SMILES | CO/N=C/c1ccc(-n2nc(-c3ccc(C)nc3)c3c2-c2sc(CC(C)=O)nc2CC3)cc1 |
| InChI | InChI=1S/C25H23N5O2S/c1-15-4-7-18(14-26-15)23-20-10-11-21-25(33-22(28-21)12-16(2)31)24(20)30(29-23)19-8-5-17(6-9-19)13-27-32-3/h4-9,13-14H,10-12H2,1-3H3/b27-13+ |
| InChIKey | UGAUGCXBQZIVSL-UVHMKAGCSA-N |
| XLogP | 4.58 |
| TPSA | 82.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|