C23H20F3N5O2 — CID 58266278
4-[(4R)-2,5-dioxo-7-propan-2-yl-1-[3-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydropyrimido[4,5-d]pyridazin-4-yl]benzonitrile (PubChem CID 58266278) has the molecular formula C23H20F3N5O2 and a molecular weight of 455.44 g/mol. Its IUPAC name is 4-[(4R)-2,5-dioxo-7-propan-2-yl-1-[3-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydropyrimido[4,5-d]pyridazin-4-yl]benzonitrile.
| Compound Name | 4-[(4R)-2,5-dioxo-7-propan-2-yl-1-[3-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydropyrimido[4,5-d]pyridazin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 58266278 |
| Molecular Formula | C23H20F3N5O2 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 4-[(4R)-2,5-dioxo-7-propan-2-yl-1-[3-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydropyrimido[4,5-d]pyridazin-4-yl]benzonitrile |
| SMILES | CC(C)N1CC2=C(C(=O)N1)[C@@H](c1ccc(C#N)cc1)NC(=O)N2c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20F3N5O2/c1-13(2)30-12-18-19(21(32)29-30)20(15-8-6-14(11-27)7-9-15)28-22(33)31(18)17-5-3-4-16(10-17)23(24,25)26/h3-10,13,20H,12H2,1-2H3,(H,28,33)(H,29,32)/t20-/m1/s1 |
| InChIKey | CLAQELWUROITOO-HXUWFJFHSA-N |
| XLogP | 3.86 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |