C24H20F3N5O2 — CID 67153166
4-[7-(cyclopropylmethyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydropyrimido[4,5-d]pyridazin-4-yl]benzonitrile (PubChem CID 67153166) has the molecular formula C24H20F3N5O2 and a molecular weight of 467.45 g/mol. Its IUPAC name is 4-[7-(cyclopropylmethyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydropyrimido[4,5-d]pyridazin-4-yl]benzonitrile.
| Compound Name | 4-[7-(cyclopropylmethyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydropyrimido[4,5-d]pyridazin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 67153166 |
| Molecular Formula | C24H20F3N5O2 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 4-[7-(cyclopropylmethyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydropyrimido[4,5-d]pyridazin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2NC(=O)N(c3cccc(C(F)(F)F)c3)C3=C2C(=O)NN(CC2CC2)C3)cc1 |
| InChI | InChI=1S/C24H20F3N5O2/c25-24(26,27)17-2-1-3-18(10-17)32-19-13-31(12-15-4-5-15)30-22(33)20(19)21(29-23(32)34)16-8-6-14(11-28)7-9-16/h1-3,6-10,15,21H,4-5,12-13H2,(H,29,34)(H,30,33) |
| InChIKey | QXNSWSOUVNSQHX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |