C19H13N5 — CID 58266413
12-(2,3-dihydroindol-1-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 58266413) has the molecular formula C19H13N5 and a molecular weight of 311.35 g/mol. Its IUPAC name is 12-(2,3-dihydroindol-1-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-(2,3-dihydroindol-1-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266413 |
| Molecular Formula | C19H13N5 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 12-(2,3-dihydroindol-1-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(N3CCc4ccccc43)cc12 |
| InChI | InChI=1S/C19H13N5/c20-9-13-7-15-16-8-14(10-22-19(16)23-17(15)11-21-13)24-6-5-12-3-1-2-4-18(12)24/h1-4,7-8,10-11H,5-6H2,(H,22,23) |
| InChIKey | DJPDZQYTRCUWTA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |