C31H28N4O5 — CID 58268747
4-[2-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]acetyl]-5-methyl-2-phenyl-1-prop-2-enylpyrazol-3-one (PubChem CID 58268747) has the molecular formula C31H28N4O5 and a molecular weight of 536.59 g/mol. Its IUPAC name is 4-[2-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]acetyl]-5-methyl-2-phenyl-1-prop-2-enylpyrazol-3-one.
| Compound Name | 4-[2-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]acetyl]-5-methyl-2-phenyl-1-prop-2-enylpyrazol-3-one |
|---|---|
| PubChem CID | 58268747 |
| Molecular Formula | C31H28N4O5 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 4-[2-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]acetyl]-5-methyl-2-phenyl-1-prop-2-enylpyrazol-3-one |
| SMILES | C=CCn1c(C)c(C(=O)Cc2ccc(Oc3ccnc4cc(OC)c(OC)cc34)cn2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C31H28N4O5/c1-5-15-34-20(2)30(31(37)35(34)22-9-7-6-8-10-22)26(36)16-21-11-12-23(19-33-21)40-27-13-14-32-25-18-29(39-4)28(38-3)17-24(25)27/h5-14,17-19H,1,15-16H2,2-4H3 |
| InChIKey | LDSQKPALTDZFKM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 97.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|