C24H22F3N5O3 — CID 58269622
N-(diaminomethylidene)-4-[1-[3-(1,3-oxazol-5-yl)benzoyl]piperidin-4-yl]-3-(trifluoromethyl)benzamide (PubChem CID 58269622) has the molecular formula C24H22F3N5O3 and a molecular weight of 485.47 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[1-[3-(1,3-oxazol-5-yl)benzoyl]piperidin-4-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-(diaminomethylidene)-4-[1-[3-(1,3-oxazol-5-yl)benzoyl]piperidin-4-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58269622 |
| Molecular Formula | C24H22F3N5O3 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | N-(diaminomethylidene)-4-[1-[3-(1,3-oxazol-5-yl)benzoyl]piperidin-4-yl]-3-(trifluoromethyl)benzamide |
| SMILES | NC(N)=NC(=O)c1ccc(C2CCN(C(=O)c3cccc(-c4cnco4)c3)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H22F3N5O3/c25-24(26,27)19-11-16(21(33)31-23(28)29)4-5-18(19)14-6-8-32(9-7-14)22(34)17-3-1-2-15(10-17)20-12-30-13-35-20/h1-5,10-14H,6-9H2,(H4,28,29,31,33) |
| InChIKey | XRULFOFIOBXDAX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 127.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|