C31H49NO4 — CID 58271423
2-[2-methoxy-5-[1-methoxy-2-[6-[4-(2-methylphenyl)butoxy]hexylamino]ethyl]-3-methylphenyl]propan-2-ol (PubChem CID 58271423) has the molecular formula C31H49NO4 and a molecular weight of 499.74 g/mol. Its IUPAC name is 2-[2-methoxy-5-[1-methoxy-2-[6-[4-(2-methylphenyl)butoxy]hexylamino]ethyl]-3-methylphenyl]propan-2-ol.
| Compound Name | 2-[2-methoxy-5-[1-methoxy-2-[6-[4-(2-methylphenyl)butoxy]hexylamino]ethyl]-3-methylphenyl]propan-2-ol |
|---|---|
| PubChem CID | 58271423 |
| Molecular Formula | C31H49NO4 |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.37 |
| IUPAC Name | 2-[2-methoxy-5-[1-methoxy-2-[6-[4-(2-methylphenyl)butoxy]hexylamino]ethyl]-3-methylphenyl]propan-2-ol |
| SMILES | COc1c(C)cc(C(CNCCCCCCOCCCCc2ccccc2C)OC)cc1C(C)(C)O |
| InChI | InChI=1S/C31H49NO4/c1-24-15-9-10-16-26(24)17-11-14-20-36-19-13-8-7-12-18-32-23-29(34-5)27-21-25(2)30(35-6)28(22-27)31(3,4)33/h9-10,15-16,21-22,29,32-33H,7-8,11-14,17-20,23H2,1-6H3 |
| InChIKey | HHALQUQBNBAOAX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|