C7H12N2O3 — CID 58271880
2-amino-3-(2-methylprop-2-enoylamino)propanoic acid (PubChem CID 58271880) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-amino-3-(2-methylprop-2-enoylamino)propanoic acid.
| Compound Name | 2-amino-3-(2-methylprop-2-enoylamino)propanoic acid |
|---|---|
| PubChem CID | 58271880 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 2-amino-3-(2-methylprop-2-enoylamino)propanoic acid |
| SMILES | C=C(C)C(=O)NCC(N)C(=O)O |
| InChI | InChI=1S/C7H12N2O3/c1-4(2)6(10)9-3-5(8)7(11)12/h5H,1,3,8H2,2H3,(H,9,10)(H,11,12) |
| InChIKey | SXJFNMNUUHZGSJ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|