C11H21N2O3+ — CID 22178958
2-carboxyethyl-dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azanium (PubChem CID 22178958) has the molecular formula C11H21N2O3+ and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-carboxyethyl-dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azanium.
| Compound Name | 2-carboxyethyl-dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 22178958 |
| Molecular Formula | C11H21N2O3+ |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-carboxyethyl-dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azanium |
| SMILES | C=C(C)C(=O)NCC[N+](C)(C)CCC(=O)O |
| InChI | InChI=1S/C11H20N2O3/c1-9(2)11(16)12-6-8-13(3,4)7-5-10(14)15/h1,5-8H2,2-4H3,(H-,12,14,15,16)/p+1 |
| InChIKey | DSRBBLBNWKUABK-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|