C10H17N2O5+ — CID 22476916
dicarboxy-methyl-[3-(2-methylprop-2-enoylamino)propyl]azanium (PubChem CID 22476916) has the molecular formula C10H17N2O5+ and a molecular weight of 245.25 g/mol. Its IUPAC name is dicarboxy-methyl-[3-(2-methylprop-2-enoylamino)propyl]azanium.
| Compound Name | dicarboxy-methyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 22476916 |
| Molecular Formula | C10H17N2O5+ |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | dicarboxy-methyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O5/c1-7(2)8(13)11-5-4-6-12(3,9(14)15)10(16)17/h1,4-6H2,2-3H3,(H2-,11,13,14,15,16,17)/p+1 |
| InChIKey | IIOKCGBOLRADDH-UHFFFAOYSA-O |
| XLogP | 0.87 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|