C10H20N2O4 — CID 22402579
carbonic acid;N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide (PubChem CID 22402579) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is carbonic acid;N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide.
| Compound Name | carbonic acid;N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 22402579 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | carbonic acid;N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCN(C)C.O=C(O)O |
| InChI | InChI=1S/C9H18N2O.CH2O3/c1-8(2)9(12)10-6-5-7-11(3)4;2-1(3)4/h1,5-7H2,2-4H3,(H,10,12);(H2,2,3,4) |
| InChIKey | VZOWADCRJNNQIL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|