C23H38N5O5S+ — CID 58272059
[1-[2-[4-(2,4-dihydroxy-3-methylcyclobutyl)-N-ethylanilino]ethyl]triazol-4-yl]methyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 58272059) has the molecular formula C23H38N5O5S+ and a molecular weight of 496.65 g/mol. Its IUPAC name is [1-[2-[4-(2,4-dihydroxy-3-methylcyclobutyl)-N-ethylanilino]ethyl]triazol-4-yl]methyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | [1-[2-[4-(2,4-dihydroxy-3-methylcyclobutyl)-N-ethylanilino]ethyl]triazol-4-yl]methyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 58272059 |
| Molecular Formula | C23H38N5O5S+ |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | [1-[2-[4-(2,4-dihydroxy-3-methylcyclobutyl)-N-ethylanilino]ethyl]triazol-4-yl]methyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | CCN(CCn1cc(C[N+](C)(C)CCCS(=O)(=O)O)nn1)c1ccc(C2C(O)C(C)C2O)cc1 |
| InChI | InChI=1S/C23H37N5O5S/c1-5-26(20-9-7-18(8-10-20)21-22(29)17(2)23(21)30)11-12-27-15-19(24-25-27)16-28(3,4)13-6-14-34(31,32)33/h7-10,15,17,21-23,29-30H,5-6,11-14,16H2,1-4H3/p+1 |
| InChIKey | RTEJCNXDNXDSDB-UHFFFAOYSA-O |
| XLogP | 1.11 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|