C10H19N7O3S — CID 159992831
3-[4-[[3-azidopropyl(methyl)amino]methyl]triazol-1-yl]propane-1-sulfonic acid (PubChem CID 159992831) has the molecular formula C10H19N7O3S and a molecular weight of 317.38 g/mol. Its IUPAC name is 3-[4-[[3-azidopropyl(methyl)amino]methyl]triazol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[4-[[3-azidopropyl(methyl)amino]methyl]triazol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 159992831 |
| Molecular Formula | C10H19N7O3S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-[4-[[3-azidopropyl(methyl)amino]methyl]triazol-1-yl]propane-1-sulfonic acid |
| SMILES | CN(CCCN=[N+]=[N-])Cc1cn(CCCS(=O)(=O)O)nn1 |
| InChI | InChI=1S/C10H19N7O3S/c1-16(5-2-4-12-14-11)8-10-9-17(15-13-10)6-3-7-21(18,19)20/h9H,2-8H2,1H3,(H,18,19,20) |
| InChIKey | GNVLSERQSFEUSU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|