C10H16N4O — CID 61426945
3-azido-N-methyl-N-[(2-methylfuran-3-yl)methyl]propan-1-amine (PubChem CID 61426945) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-azido-N-methyl-N-[(2-methylfuran-3-yl)methyl]propan-1-amine.
| Compound Name | 3-azido-N-methyl-N-[(2-methylfuran-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 61426945 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 3-azido-N-methyl-N-[(2-methylfuran-3-yl)methyl]propan-1-amine |
| SMILES | Cc1occc1CN(C)CCCN=[N+]=[N-] |
| InChI | InChI=1S/C10H16N4O/c1-9-10(4-7-15-9)8-14(2)6-3-5-12-13-11/h4,7H,3,5-6,8H2,1-2H3 |
| InChIKey | IMDSJCRWQLTQMS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 65.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|