C16H27N7O4 — CID 161298374
3-[4-[[3-azidopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]triazol-1-yl]propyl acetate (PubChem CID 161298374) has the molecular formula C16H27N7O4 and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-[4-[[3-azidopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]triazol-1-yl]propyl acetate.
| Compound Name | 3-[4-[[3-azidopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]triazol-1-yl]propyl acetate |
|---|---|
| PubChem CID | 161298374 |
| Molecular Formula | C16H27N7O4 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3-[4-[[3-azidopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]triazol-1-yl]propyl acetate |
| SMILES | CC(=O)OCCCn1cc(CN(CCCN=[N+]=[N-])C(=O)OC(C)(C)C)nn1 |
| InChI | InChI=1S/C16H27N7O4/c1-13(24)26-10-6-9-23-12-14(19-21-23)11-22(8-5-7-18-20-17)15(25)27-16(2,3)4/h12H,5-11H2,1-4H3 |
| InChIKey | JTEFJGFXFFKBDF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 135.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|