C18H34N10O3 — CID 118600931
3-[4-[[2-[[3-hydroxypropyl(methyl)amino]diazenyl]ethyl-[[1-(3-hydroxypropyl)triazol-4-yl]methyl]amino]methyl]triazol-1-yl]propan-1-ol (PubChem CID 118600931) has the molecular formula C18H34N10O3 and a molecular weight of 438.54 g/mol. Its IUPAC name is 3-[4-[[2-[[3-hydroxypropyl(methyl)amino]diazenyl]ethyl-[[1-(3-hydroxypropyl)triazol-4-yl]methyl]amino]methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[[2-[[3-hydroxypropyl(methyl)amino]diazenyl]ethyl-[[1-(3-hydroxypropyl)triazol-4-yl]methyl]amino]methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 118600931 |
| Molecular Formula | C18H34N10O3 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 3-[4-[[2-[[3-hydroxypropyl(methyl)amino]diazenyl]ethyl-[[1-(3-hydroxypropyl)triazol-4-yl]methyl]amino]methyl]triazol-1-yl]propan-1-ol |
| SMILES | CN(CCCO)/N=N/CCN(Cc1cn(CCCO)nn1)Cc1cn(CCCO)nn1 |
| InChI | InChI=1S/C18H34N10O3/c1-25(6-2-10-29)22-19-5-9-26(13-17-15-27(23-20-17)7-3-11-30)14-18-16-28(24-21-18)8-4-12-31/h15-16,29-31H,2-14H2,1H3/b22-19+ |
| InChIKey | FPMQKCXXNKXBQF-ZBJSNUHESA-N |
| XLogP | -0.68 |
| TPSA | 153.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|