C19H32N10O — CID 66749153
2-[4-[[bis[(1-tert-butyltriazol-4-yl)methyl]amino]methyl]triazol-1-yl]ethanol (PubChem CID 66749153) has the molecular formula C19H32N10O and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-[4-[[bis[(1-tert-butyltriazol-4-yl)methyl]amino]methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[[bis[(1-tert-butyltriazol-4-yl)methyl]amino]methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 66749153 |
| Molecular Formula | C19H32N10O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 2-[4-[[bis[(1-tert-butyltriazol-4-yl)methyl]amino]methyl]triazol-1-yl]ethanol |
| SMILES | CC(C)(C)n1cc(CN(Cc2cn(CCO)nn2)Cc2cn(C(C)(C)C)nn2)nn1 |
| InChI | InChI=1S/C19H32N10O/c1-18(2,3)28-13-16(21-24-28)10-26(9-15-12-27(7-8-30)23-20-15)11-17-14-29(25-22-17)19(4,5)6/h12-14,30H,7-11H2,1-6H3 |
| InChIKey | XBVKUBCNAWDEHC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |