C7H14N4O — CID 62399765
[1-[2-(dimethylamino)ethyl]triazol-4-yl]methanol (PubChem CID 62399765) has the molecular formula C7H14N4O and a molecular weight of 170.22 g/mol. Its IUPAC name is [1-[2-(dimethylamino)ethyl]triazol-4-yl]methanol.
| Compound Name | [1-[2-(dimethylamino)ethyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 62399765 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | [1-[2-(dimethylamino)ethyl]triazol-4-yl]methanol |
| SMILES | CN(C)CCn1cc(CO)nn1 |
| InChI | InChI=1S/C7H14N4O/c1-10(2)3-4-11-5-7(6-12)8-9-11/h5,12H,3-4,6H2,1-2H3 |
| InChIKey | AKOZWELUPNOSFF-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |