C10H20N4O2 — CID 165456647
3-[[1-[2-(dimethylamino)ethyl]triazol-4-yl]methoxy]propan-1-ol (PubChem CID 165456647) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-[[1-[2-(dimethylamino)ethyl]triazol-4-yl]methoxy]propan-1-ol.
| Compound Name | 3-[[1-[2-(dimethylamino)ethyl]triazol-4-yl]methoxy]propan-1-ol |
|---|---|
| PubChem CID | 165456647 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 3-[[1-[2-(dimethylamino)ethyl]triazol-4-yl]methoxy]propan-1-ol |
| SMILES | CN(C)CCn1cc(COCCCO)nn1 |
| InChI | InChI=1S/C10H20N4O2/c1-13(2)4-5-14-8-10(11-12-14)9-16-7-3-6-15/h8,15H,3-7,9H2,1-2H3 |
| InChIKey | CPJOQEFTBWYVPQ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|