C13H20N6O — CID 138618306
4-[[1-[2-(dimethylamino)ethyl]triazol-4-yl]methoxy]benzene-1,2-diamine (PubChem CID 138618306) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-[[1-[2-(dimethylamino)ethyl]triazol-4-yl]methoxy]benzene-1,2-diamine.
| Compound Name | 4-[[1-[2-(dimethylamino)ethyl]triazol-4-yl]methoxy]benzene-1,2-diamine |
|---|---|
| PubChem CID | 138618306 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 4-[[1-[2-(dimethylamino)ethyl]triazol-4-yl]methoxy]benzene-1,2-diamine |
| SMILES | CN(C)CCn1cc(COc2ccc(N)c(N)c2)nn1 |
| InChI | InChI=1S/C13H20N6O/c1-18(2)5-6-19-8-10(16-17-19)9-20-11-3-4-12(14)13(15)7-11/h3-4,7-8H,5-6,9,14-15H2,1-2H3 |
| InChIKey | SGHWJLQHJQYZBG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|