C13H17ClN4O3S — CID 166265955
N-[2-[4-[(3-chlorophenoxy)methyl]triazol-1-yl]ethyl]-N-methylmethanesulfonamide (PubChem CID 166265955) has the molecular formula C13H17ClN4O3S and a molecular weight of 344.82 g/mol. Its IUPAC name is N-[2-[4-[(3-chlorophenoxy)methyl]triazol-1-yl]ethyl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-[4-[(3-chlorophenoxy)methyl]triazol-1-yl]ethyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 166265955 |
| Molecular Formula | C13H17ClN4O3S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-[2-[4-[(3-chlorophenoxy)methyl]triazol-1-yl]ethyl]-N-methylmethanesulfonamide |
| SMILES | CN(CCn1cc(COc2cccc(Cl)c2)nn1)S(C)(=O)=O |
| InChI | InChI=1S/C13H17ClN4O3S/c1-17(22(2,19)20)6-7-18-9-12(15-16-18)10-21-13-5-3-4-11(14)8-13/h3-5,8-9H,6-7,10H2,1-2H3 |
| InChIKey | GEXNPVPYJVGEIK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |