C57H44N6 — CID 58273818
2-[2-(4,6-diphenyl-1,3,5-triazinan-2-yl)-7,7'-dimethyl-9,9'-spirobi[fluorene]-2'-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 58273818) has the molecular formula C57H44N6 and a molecular weight of 813.02 g/mol. Its IUPAC name is 2-[2-(4,6-diphenyl-1,3,5-triazinan-2-yl)-7,7'-dimethyl-9,9'-spirobi[fluorene]-2'-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[2-(4,6-diphenyl-1,3,5-triazinan-2-yl)-7,7'-dimethyl-9,9'-spirobi[fluorene]-2'-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 58273818 |
| Molecular Formula | C57H44N6 |
| Molecular Weight | 813.02 g/mol |
| Exact Mass | 812.36 |
| IUPAC Name | 2-[2-(4,6-diphenyl-1,3,5-triazinan-2-yl)-7,7'-dimethyl-9,9'-spirobi[fluorene]-2'-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1ccc2c(c1)C1(c3cc(C)ccc3-c3ccc(C4NC(c5ccccc5)NC(c5ccccc5)N4)cc31)c1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc1-2 |
| InChI | InChI=1S/C57H44N6/c1-35-23-27-43-45-29-25-41(55-60-51(37-15-7-3-8-16-37)58-52(61-55)38-17-9-4-10-18-38)33-49(45)57(47(43)31-35)48-32-36(2)24-28-44(48)46-30-26-42(34-50(46)57)56-62-53(39-19-11-5-12-20-39)59-54(63-56)40-21-13-6-14-22-40/h3-34,51-52,55,58,60-61H,1-2H3 |
| InChIKey | CMLDATSXZUEWSP-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.02 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |