C26H34F9N3O12 — CID 58275065
methyl 2-[[2-[[2-[bis(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]-[2-[4,4,4-trifluoro-2,2-bis(2,2,2-trifluoroethyl)butoxy]acetyl]amino]acetyl]-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 58275065) has the molecular formula C26H34F9N3O12 and a molecular weight of 751.55 g/mol. Its IUPAC name is methyl 2-[[2-[[2-[bis(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]-[2-[4,4,4-trifluoro-2,2-bis(2,2,2-trifluoroethyl)butoxy]acetyl]amino]acetyl]-(2-methoxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[[2-[[2-[bis(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]-[2-[4,4,4-trifluoro-2,2-bis(2,2,2-trifluoroethyl)butoxy]acetyl]amino]acetyl]-(2-methoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 58275065 |
| Molecular Formula | C26H34F9N3O12 |
| Molecular Weight | 751.55 g/mol |
| Exact Mass | 751.20 |
| IUPAC Name | methyl 2-[[2-[[2-[bis(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]-[2-[4,4,4-trifluoro-2,2-bis(2,2,2-trifluoroethyl)butoxy]acetyl]amino]acetyl]-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)C(=O)CN(CC(=O)N(CC(=O)OC)CC(=O)OC)C(=O)COCC(CC(F)(F)F)(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C26H34F9N3O12/c1-46-19(42)7-37(8-20(43)47-2)16(39)5-36(6-17(40)38(9-21(44)48-3)10-22(45)49-4)18(41)11-50-15-23(12-24(27,28)29,13-25(30,31)32)14-26(33,34)35/h5-15H2,1-4H3 |
| InChIKey | RXHUGEOLKVWRBT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 175.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.55 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|