C19H20O9 — CID 58275149
6-(3,4,5-trihydroxy-8-methoxycarbonyl-6-oxobenzo[7]annulen-2-yl)oxyhexanoic acid (PubChem CID 58275149) has the molecular formula C19H20O9 and a molecular weight of 392.36 g/mol. Its IUPAC name is 6-(3,4,5-trihydroxy-8-methoxycarbonyl-6-oxobenzo[7]annulen-2-yl)oxyhexanoic acid.
| Compound Name | 6-(3,4,5-trihydroxy-8-methoxycarbonyl-6-oxobenzo[7]annulen-2-yl)oxyhexanoic acid |
|---|---|
| PubChem CID | 58275149 |
| Molecular Formula | C19H20O9 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 6-(3,4,5-trihydroxy-8-methoxycarbonyl-6-oxobenzo[7]annulen-2-yl)oxyhexanoic acid |
| SMILES | COC(=O)c1cc(=O)c(O)c2c(O)c(O)c(OCCCCCC(=O)O)cc2c1 |
| InChI | InChI=1S/C19H20O9/c1-27-19(26)11-7-10-9-13(28-6-4-2-3-5-14(21)22)17(24)18(25)15(10)16(23)12(20)8-11/h7-9,24-25H,2-6H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | YRPWKVICIHGAQD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|