C27H42O8 — CID 23344869
ethyl 6-[2-(2,2-dimethylpropanoyloxymethyl)-6-[(E)-3-hydroxyoct-1-enyl]-4-oxopyran-3-yl]oxyhexanoate (PubChem CID 23344869) has the molecular formula C27H42O8 and a molecular weight of 494.63 g/mol. Its IUPAC name is ethyl 6-[2-(2,2-dimethylpropanoyloxymethyl)-6-[(E)-3-hydroxyoct-1-enyl]-4-oxopyran-3-yl]oxyhexanoate.
| Compound Name | ethyl 6-[2-(2,2-dimethylpropanoyloxymethyl)-6-[(E)-3-hydroxyoct-1-enyl]-4-oxopyran-3-yl]oxyhexanoate |
|---|---|
| PubChem CID | 23344869 |
| Molecular Formula | C27H42O8 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | ethyl 6-[2-(2,2-dimethylpropanoyloxymethyl)-6-[(E)-3-hydroxyoct-1-enyl]-4-oxopyran-3-yl]oxyhexanoate |
| SMILES | CCCCCC(O)/C=C/c1cc(=O)c(OCCCCCC(=O)OCC)c(COC(=O)C(C)(C)C)o1 |
| InChI | InChI=1S/C27H42O8/c1-6-8-10-13-20(28)15-16-21-18-22(29)25(23(35-21)19-34-26(31)27(3,4)5)33-17-12-9-11-14-24(30)32-7-2/h15-16,18,20,28H,6-14,17,19H2,1-5H3/b16-15+ |
| InChIKey | GFAKUHFNQHUGMI-FOCLMDBBSA-N |
| XLogP | 5.19 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|