C22H34O6 — CID 23344866
ethyl 6-[2-[(E)-3-hydroxyoct-1-enyl]-6-methyl-4-oxopyran-3-yl]oxyhexanoate (PubChem CID 23344866) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is ethyl 6-[2-[(E)-3-hydroxyoct-1-enyl]-6-methyl-4-oxopyran-3-yl]oxyhexanoate.
| Compound Name | ethyl 6-[2-[(E)-3-hydroxyoct-1-enyl]-6-methyl-4-oxopyran-3-yl]oxyhexanoate |
|---|---|
| PubChem CID | 23344866 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | ethyl 6-[2-[(E)-3-hydroxyoct-1-enyl]-6-methyl-4-oxopyran-3-yl]oxyhexanoate |
| SMILES | CCCCCC(O)/C=C/c1oc(C)cc(=O)c1OCCCCCC(=O)OCC |
| InChI | InChI=1S/C22H34O6/c1-4-6-8-11-18(23)13-14-20-22(19(24)16-17(3)28-20)27-15-10-7-9-12-21(25)26-5-2/h13-14,16,18,23H,4-12,15H2,1-3H3/b14-13+ |
| InChIKey | JXQDCSJFXWTMQL-BUHFOSPRSA-N |
| XLogP | 4.40 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|