C24H17N3OS — CID 58278817
2-(2-phenylphenyl)-N-(1,3-thiazol-2-yl)-3H-indole-7-carboxamide (PubChem CID 58278817) has the molecular formula C24H17N3OS and a molecular weight of 395.49 g/mol. Its IUPAC name is 2-(2-phenylphenyl)-N-(1,3-thiazol-2-yl)-3H-indole-7-carboxamide.
| Compound Name | 2-(2-phenylphenyl)-N-(1,3-thiazol-2-yl)-3H-indole-7-carboxamide |
|---|---|
| PubChem CID | 58278817 |
| Molecular Formula | C24H17N3OS |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-(2-phenylphenyl)-N-(1,3-thiazol-2-yl)-3H-indole-7-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cccc2c1N=C(c1ccccc1-c1ccccc1)C2 |
| InChI | InChI=1S/C24H17N3OS/c28-23(27-24-25-13-14-29-24)20-12-6-9-17-15-21(26-22(17)20)19-11-5-4-10-18(19)16-7-2-1-3-8-16/h1-14H,15H2,(H,25,27,28) |
| InChIKey | HBSKEIBYROTQRU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |