C31H18F6O4 — CID 58280696
2-[6-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-9-oxoxanthen-2-yl]-7-methylxanthen-9-one (PubChem CID 58280696) has the molecular formula C31H18F6O4 and a molecular weight of 568.47 g/mol. Its IUPAC name is 2-[6-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-9-oxoxanthen-2-yl]-7-methylxanthen-9-one.
| Compound Name | 2-[6-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-9-oxoxanthen-2-yl]-7-methylxanthen-9-one |
|---|---|
| PubChem CID | 58280696 |
| Molecular Formula | C31H18F6O4 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 2-[6-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-9-oxoxanthen-2-yl]-7-methylxanthen-9-one |
| SMILES | Cc1ccc2oc3ccc(-c4ccc5oc6cc(C(C)(C(F)(F)F)C(F)(F)F)ccc6c(=O)c5c4)cc3c(=O)c2c1 |
| InChI | InChI=1S/C31H18F6O4/c1-15-3-8-23-20(11-15)28(39)22-13-17(4-9-24(22)40-23)16-5-10-25-21(12-16)27(38)19-7-6-18(14-26(19)41-25)29(2,30(32,33)34)31(35,36)37/h3-14H,1-2H3 |
| InChIKey | JASIKJFYXGOPPQ-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|