C21H24N6S — CID 58285501
5-[3-(dimethylamino)phenyl]-N-[[4-(dimethylamino)phenyl]methyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 58285501) has the molecular formula C21H24N6S and a molecular weight of 392.53 g/mol. Its IUPAC name is 5-[3-(dimethylamino)phenyl]-N-[[4-(dimethylamino)phenyl]methyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | 5-[3-(dimethylamino)phenyl]-N-[[4-(dimethylamino)phenyl]methyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 58285501 |
| Molecular Formula | C21H24N6S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 5-[3-(dimethylamino)phenyl]-N-[[4-(dimethylamino)phenyl]methyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | CN(C)c1ccc(CNc2nn3c(-c4cccc(N(C)C)c4)cnc3s2)cc1 |
| InChI | InChI=1S/C21H24N6S/c1-25(2)17-10-8-15(9-11-17)13-22-20-24-27-19(14-23-21(27)28-20)16-6-5-7-18(12-16)26(3)4/h5-12,14H,13H2,1-4H3,(H,22,24) |
| InChIKey | GVBUUQIHDXBVAY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 48.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|