C19H19N5S — CID 58285460
N-[[4-(dimethylamino)phenyl]methyl]-5-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 58285460) has the molecular formula C19H19N5S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-5-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-5-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 58285460 |
| Molecular Formula | C19H19N5S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-5-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | CN(C)c1ccc(CNc2nn3c(-c4ccccc4)cnc3s2)cc1 |
| InChI | InChI=1S/C19H19N5S/c1-23(2)16-10-8-14(9-11-16)12-20-18-22-24-17(13-21-19(24)25-18)15-6-4-3-5-7-15/h3-11,13H,12H2,1-2H3,(H,20,22) |
| InChIKey | SMMANFPTBXTVFY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|