C25H19N3O7S — CID 58285966
(4E)-4-[(2,5-dimethylfuran-3-yl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 58285966) has the molecular formula C25H19N3O7S and a molecular weight of 505.51 g/mol. Its IUPAC name is (4E)-4-[(2,5-dimethylfuran-3-yl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(2,5-dimethylfuran-3-yl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 58285966 |
| Molecular Formula | C25H19N3O7S |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | (4E)-4-[(2,5-dimethylfuran-3-yl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4cc(C)oc4C)C3c3cccc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C25H19N3O7S/c1-12-9-17(13(2)35-12)22(29)20-21(14-5-4-6-15(10-14)28(32)33)27(24(31)23(20)30)25-26-18-8-7-16(34-3)11-19(18)36-25/h4-11,21,29H,1-3H3/b22-20+ |
| InChIKey | JMKDGPLOWNNEPQ-LSDHQDQOSA-N |
| XLogP | 5.05 |
| TPSA | 136.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|