C24H16ClN3O6S — CID 58286074
(4E)-5-(4-chlorophenyl)-4-[(2,5-dimethylfuran-3-yl)-hydroxymethylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 58286074) has the molecular formula C24H16ClN3O6S and a molecular weight of 509.93 g/mol. Its IUPAC name is (4E)-5-(4-chlorophenyl)-4-[(2,5-dimethylfuran-3-yl)-hydroxymethylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-chlorophenyl)-4-[(2,5-dimethylfuran-3-yl)-hydroxymethylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 58286074 |
| Molecular Formula | C24H16ClN3O6S |
| Molecular Weight | 509.93 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | (4E)-5-(4-chlorophenyl)-4-[(2,5-dimethylfuran-3-yl)-hydroxymethylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1cc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc([N+](=O)[O-])cc4s3)C2c2ccc(Cl)cc2)c(C)o1 |
| InChI | InChI=1S/C24H16ClN3O6S/c1-11-9-16(12(2)34-11)21(29)19-20(13-3-5-14(25)6-4-13)27(23(31)22(19)30)24-26-17-8-7-15(28(32)33)10-18(17)35-24/h3-10,20,29H,1-2H3/b21-19+ |
| InChIKey | ZWLNAQSOTYPDLE-XUTLUUPISA-N |
| XLogP | 5.69 |
| TPSA | 126.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.93 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|