C19H14ClN3O4S — CID 58286124
(4E)-5-(4-chlorophenyl)-4-[(2,5-dimethylfuran-3-yl)-hydroxymethylidene]-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 58286124) has the molecular formula C19H14ClN3O4S and a molecular weight of 415.86 g/mol. Its IUPAC name is (4E)-5-(4-chlorophenyl)-4-[(2,5-dimethylfuran-3-yl)-hydroxymethylidene]-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-chlorophenyl)-4-[(2,5-dimethylfuran-3-yl)-hydroxymethylidene]-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 58286124 |
| Molecular Formula | C19H14ClN3O4S |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | (4E)-5-(4-chlorophenyl)-4-[(2,5-dimethylfuran-3-yl)-hydroxymethylidene]-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1cc(/C(O)=C2\C(=O)C(=O)N(c3nncs3)C2c2ccc(Cl)cc2)c(C)o1 |
| InChI | InChI=1S/C19H14ClN3O4S/c1-9-7-13(10(2)27-9)16(24)14-15(11-3-5-12(20)6-4-11)23(18(26)17(14)25)19-22-21-8-28-19/h3-8,15,24H,1-2H3/b16-14+ |
| InChIKey | GBYDYSWADRAEJI-JQIJEIRASA-N |
| XLogP | 4.03 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|