C29H29F2N5O3 — CID 58286431
(2R)-1-[(1S,4S)-5-(1H-benzimidazole-2-carbonyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-(5,7-difluoro-1H-indol-2-yl)-2-(2-methylpropyl)butane-1,4-dione (PubChem CID 58286431) has the molecular formula C29H29F2N5O3 and a molecular weight of 533.58 g/mol. Its IUPAC name is (2R)-1-[(1S,4S)-5-(1H-benzimidazole-2-carbonyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-(5,7-difluoro-1H-indol-2-yl)-2-(2-methylpropyl)butane-1,4-dione.
| Compound Name | (2R)-1-[(1S,4S)-5-(1H-benzimidazole-2-carbonyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-(5,7-difluoro-1H-indol-2-yl)-2-(2-methylpropyl)butane-1,4-dione |
|---|---|
| PubChem CID | 58286431 |
| Molecular Formula | C29H29F2N5O3 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | (2R)-1-[(1S,4S)-5-(1H-benzimidazole-2-carbonyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-(5,7-difluoro-1H-indol-2-yl)-2-(2-methylpropyl)butane-1,4-dione |
| SMILES | CC(C)C[C@H](CC(=O)c1cc2cc(F)cc(F)c2[nH]1)C(=O)N1C[C@@H]2C[C@H]1CN2C(=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C29H29F2N5O3/c1-15(2)7-17(10-25(37)24-9-16-8-18(30)11-21(31)26(16)32-24)28(38)35-13-20-12-19(35)14-36(20)29(39)27-33-22-5-3-4-6-23(22)34-27/h3-6,8-9,11,15,17,19-20,32H,7,10,12-14H2,1-2H3,(H,33,34)/t17-,19+,20+/m1/s1 |
| InChIKey | KWKOWPPAQDKECG-HOJAQTOUSA-N |
| XLogP | 4.68 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |