C12H14FIN2O5 — CID 58287989
[(2R,4S,5R)-2-ethyl-4-fluoro-5-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate (PubChem CID 58287989) has the molecular formula C12H14FIN2O5 and a molecular weight of 412.16 g/mol. Its IUPAC name is [(2R,4S,5R)-2-ethyl-4-fluoro-5-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate.
| Compound Name | [(2R,4S,5R)-2-ethyl-4-fluoro-5-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 58287989 |
| Molecular Formula | C12H14FIN2O5 |
| Molecular Weight | 412.16 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | [(2R,4S,5R)-2-ethyl-4-fluoro-5-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](n2cc(I)c(=O)[nH]c2=O)[C@@H](F)C1OC(C)=O |
| InChI | InChI=1S/C12H14FIN2O5/c1-3-7-9(20-5(2)17)8(13)11(21-7)16-4-6(14)10(18)15-12(16)19/h4,7-9,11H,3H2,1-2H3,(H,15,18,19)/t7-,8+,9?,11-/m1/s1 |
| InChIKey | DIJOUEIGBMZSAG-GQEBFOJWSA-N |
| XLogP | 0.72 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.16 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|