C36H35N3O7 — CID 58289422
[1-[4-[4-[(E)-N-ethoxycarbonyloxy-C-methylcarbonimidoyl]-N-[4-(3-methylbenzoyl)phenyl]anilino]phenyl]ethylideneamino] ethyl carbonate (PubChem CID 58289422) has the molecular formula C36H35N3O7 and a molecular weight of 621.69 g/mol. Its IUPAC name is [1-[4-[4-[(E)-N-ethoxycarbonyloxy-C-methylcarbonimidoyl]-N-[4-(3-methylbenzoyl)phenyl]anilino]phenyl]ethylideneamino] ethyl carbonate.
| Compound Name | [1-[4-[4-[(E)-N-ethoxycarbonyloxy-C-methylcarbonimidoyl]-N-[4-(3-methylbenzoyl)phenyl]anilino]phenyl]ethylideneamino] ethyl carbonate |
|---|---|
| PubChem CID | 58289422 |
| Molecular Formula | C36H35N3O7 |
| Molecular Weight | 621.69 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | [1-[4-[4-[(E)-N-ethoxycarbonyloxy-C-methylcarbonimidoyl]-N-[4-(3-methylbenzoyl)phenyl]anilino]phenyl]ethylideneamino] ethyl carbonate |
| SMILES | CCOC(=O)ON=C(C)c1ccc(N(c2ccc(C(=O)c3cccc(C)c3)cc2)c2ccc(/C(C)=N/OC(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C36H35N3O7/c1-6-43-35(41)45-37-25(4)27-11-17-31(18-12-27)39(32-19-13-28(14-20-32)26(5)38-46-36(42)44-7-2)33-21-15-29(16-22-33)34(40)30-10-8-9-24(3)23-30/h8-23H,6-7H2,1-5H3/b37-25+,38-26? |
| InChIKey | WSXJPSUJOBHAFA-BFEJEFTASA-N |
| XLogP | 8.49 |
| TPSA | 116.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.69 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|