C28H31N9O2 — CID 58289755
tert-butyl 5-[2-[3-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-3-yl]methyl]phenyl]pyrimidin-5-yl]pentanoate (PubChem CID 58289755) has the molecular formula C28H31N9O2 and a molecular weight of 525.62 g/mol. Its IUPAC name is tert-butyl 5-[2-[3-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-3-yl]methyl]phenyl]pyrimidin-5-yl]pentanoate.
| Compound Name | tert-butyl 5-[2-[3-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-3-yl]methyl]phenyl]pyrimidin-5-yl]pentanoate |
|---|---|
| PubChem CID | 58289755 |
| Molecular Formula | C28H31N9O2 |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | tert-butyl 5-[2-[3-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-3-yl]methyl]phenyl]pyrimidin-5-yl]pentanoate |
| SMILES | Cn1cc(-c2cnc3nnn(Cc4cccc(-c5ncc(CCCCC(=O)OC(C)(C)C)cn5)c4)c3n2)cn1 |
| InChI | InChI=1S/C28H31N9O2/c1-28(2,3)39-24(38)11-6-5-8-20-13-29-25(30-14-20)21-10-7-9-19(12-21)17-37-27-26(34-35-37)31-16-23(33-27)22-15-32-36(4)18-22/h7,9-10,12-16,18H,5-6,8,11,17H2,1-4H3 |
| InChIKey | QASYVHCWPPFTLG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 126.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|