C26H40BNO4 — CID 58294351
tert-butyl (2S)-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentyl]pyrrolidine-1-carboxylate (PubChem CID 58294351) has the molecular formula C26H40BNO4 and a molecular weight of 441.42 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58294351 |
| Molecular Formula | C26H40BNO4 |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | tert-butyl (2S)-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1CCC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C26H40BNO4/c1-24(2,3)30-23(29)28-16-8-9-22(28)20-11-10-19(17-20)18-12-14-21(15-13-18)27-31-25(4,5)26(6,7)32-27/h12-15,19-20,22H,8-11,16-17H2,1-7H3/t19?,20?,22-/m0/s1 |
| InChIKey | QVBTVJXWWZYNLW-AOMIVXANSA-N |
| XLogP | 5.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|