C24H31N5O2 — CID 58296476
1-[2-[4-[[2-(1,2-dimethylindol-3-yl)ethylamino]methyl]piperidin-1-yl]pyrimidin-5-yl]-2-hydroxyethanone (PubChem CID 58296476) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 1-[2-[4-[[2-(1,2-dimethylindol-3-yl)ethylamino]methyl]piperidin-1-yl]pyrimidin-5-yl]-2-hydroxyethanone.
| Compound Name | 1-[2-[4-[[2-(1,2-dimethylindol-3-yl)ethylamino]methyl]piperidin-1-yl]pyrimidin-5-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 58296476 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 1-[2-[4-[[2-(1,2-dimethylindol-3-yl)ethylamino]methyl]piperidin-1-yl]pyrimidin-5-yl]-2-hydroxyethanone |
| SMILES | Cc1c(CCNCC2CCN(c3ncc(C(=O)CO)cn3)CC2)c2ccccc2n1C |
| InChI | InChI=1S/C24H31N5O2/c1-17-20(21-5-3-4-6-22(21)28(17)2)7-10-25-13-18-8-11-29(12-9-18)24-26-14-19(15-27-24)23(31)16-30/h3-6,14-15,18,25,30H,7-13,16H2,1-2H3 |
| InChIKey | XYUWXEVUJGPUDK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|