C15H26INO2 — CID 58297737
tert-butyl N-[(1E,3S,4S,5E)-1-iodo-3,5-dimethylocta-1,5-dien-4-yl]carbamate (PubChem CID 58297737) has the molecular formula C15H26INO2 and a molecular weight of 379.28 g/mol. Its IUPAC name is tert-butyl N-[(1E,3S,4S,5E)-1-iodo-3,5-dimethylocta-1,5-dien-4-yl]carbamate.
| Compound Name | tert-butyl N-[(1E,3S,4S,5E)-1-iodo-3,5-dimethylocta-1,5-dien-4-yl]carbamate |
|---|---|
| PubChem CID | 58297737 |
| Molecular Formula | C15H26INO2 |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | tert-butyl N-[(1E,3S,4S,5E)-1-iodo-3,5-dimethylocta-1,5-dien-4-yl]carbamate |
| SMILES | CC/C=C(\C)[C@@H](NC(=O)OC(C)(C)C)[C@@H](C)/C=C/I |
| InChI | InChI=1S/C15H26INO2/c1-7-8-11(2)13(12(3)9-10-16)17-14(18)19-15(4,5)6/h8-10,12-13H,7H2,1-6H3,(H,17,18)/b10-9+,11-8+/t12-,13+/m0/s1 |
| InChIKey | VWLHQSCCKRZFMB-DNPRBABZSA-N |
| XLogP | 4.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|