C17H18F3NO — CID 58297782
1,1,2,2,3-pentadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)-N-(trideuteriomethyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine (PubChem CID 58297782) has the molecular formula C17H18F3NO and a molecular weight of 322.41 g/mol. Its IUPAC name is 1,1,2,2,3-pentadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)-N-(trideuteriomethyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine.
| Compound Name | 1,1,2,2,3-pentadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)-N-(trideuteriomethyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 58297782 |
| Molecular Formula | C17H18F3NO |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 1,1,2,2,3-pentadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)-N-(trideuteriomethyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c(C([2H])(Oc2ccc(C(F)(F)F)cc2)C([2H])([2H])C([2H])([2H])NC([2H])([2H])[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C17H18F3NO/c1-21-12-11-16(13-5-3-2-4-6-13)22-15-9-7-14(8-10-15)17(18,19)20/h2-10,16,21H,11-12H2,1H3/i1D3,2D,3D,4D,5D,6D,11D2,12D2,16D |
| InChIKey | RTHCYVBBDHJXIQ-SMXGZAERSA-N |
| XLogP | 4.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |