C17H21NO — CID 58297914
1,1,2,2,3-pentadeuterio-3-(4-methylphenoxy)-3-(2,3,4,5,6-pentadeuteriophenyl)-N-(trideuteriomethyl)propan-1-amine (PubChem CID 58297914) has the molecular formula C17H21NO and a molecular weight of 268.44 g/mol. Its IUPAC name is 1,1,2,2,3-pentadeuterio-3-(4-methylphenoxy)-3-(2,3,4,5,6-pentadeuteriophenyl)-N-(trideuteriomethyl)propan-1-amine.
| Compound Name | 1,1,2,2,3-pentadeuterio-3-(4-methylphenoxy)-3-(2,3,4,5,6-pentadeuteriophenyl)-N-(trideuteriomethyl)propan-1-amine |
|---|---|
| PubChem CID | 58297914 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 1,1,2,2,3-pentadeuterio-3-(4-methylphenoxy)-3-(2,3,4,5,6-pentadeuteriophenyl)-N-(trideuteriomethyl)propan-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c(C([2H])(Oc2ccc(C)cc2)C([2H])([2H])C([2H])([2H])NC([2H])([2H])[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C17H21NO/c1-14-8-10-16(11-9-14)19-17(12-13-18-2)15-6-4-3-5-7-15/h3-11,17-18H,12-13H2,1-2H3/i2D3,3D,4D,5D,6D,7D,12D2,13D2,17D |
| InChIKey | HBZGYXADKHAYTM-AAIRCISSSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |