C18H19NOS — CID 58297888
1,1,2,2-tetradeuterio-3-naphthalen-1-yloxy-N-(trideuteriomethyl)-3-(3,4,5-trideuteriothiophen-2-yl)propan-1-amine (PubChem CID 58297888) has the molecular formula C18H19NOS and a molecular weight of 307.48 g/mol. Its IUPAC name is 1,1,2,2-tetradeuterio-3-naphthalen-1-yloxy-N-(trideuteriomethyl)-3-(3,4,5-trideuteriothiophen-2-yl)propan-1-amine.
| Compound Name | 1,1,2,2-tetradeuterio-3-naphthalen-1-yloxy-N-(trideuteriomethyl)-3-(3,4,5-trideuteriothiophen-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 58297888 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1,1,2,2-tetradeuterio-3-naphthalen-1-yloxy-N-(trideuteriomethyl)-3-(3,4,5-trideuteriothiophen-2-yl)propan-1-amine |
| SMILES | [2H]c1sc(C(Oc2cccc3ccccc23)C([2H])([2H])C([2H])([2H])NC([2H])([2H])[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C18H19NOS/c1-19-12-11-17(18-10-5-13-21-18)20-16-9-4-7-14-6-2-3-8-15(14)16/h2-10,13,17,19H,11-12H2,1H3/i1D3,5D,10D,11D2,12D2,13D |
| InChIKey | ZEUITGRIYCTCEM-YUIISODSSA-N |
| XLogP | 4.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |