C24H25N9 — CID 58299570
8-cyclopentyl-5-[(5-piperazin-1-yl-2-pyridinyl)amino]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-10-carbonitrile (PubChem CID 58299570) has the molecular formula C24H25N9 and a molecular weight of 439.53 g/mol. Its IUPAC name is 8-cyclopentyl-5-[(5-piperazin-1-yl-2-pyridinyl)amino]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-10-carbonitrile.
| Compound Name | 8-cyclopentyl-5-[(5-piperazin-1-yl-2-pyridinyl)amino]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-10-carbonitrile |
|---|---|
| PubChem CID | 58299570 |
| Molecular Formula | C24H25N9 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 8-cyclopentyl-5-[(5-piperazin-1-yl-2-pyridinyl)amino]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-10-carbonitrile |
| SMILES | N#Cc1nccc2c3cnc(Nc4ccc(N5CCNCC5)cn4)nc3n(C3CCCC3)c12 |
| InChI | InChI=1S/C24H25N9/c25-13-20-22-18(7-8-27-20)19-15-29-24(31-23(19)33(22)16-3-1-2-4-16)30-21-6-5-17(14-28-21)32-11-9-26-10-12-32/h5-8,14-16,26H,1-4,9-12H2,(H,28,29,30,31) |
| InChIKey | UOXNTMLLQKBLLA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 107.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |